CAS 66695-96-3 appears in our catalog under these names: 3-(3-Aminophenyl)-1-phenylurea, 1-(3-Aminophenyl)-3-phenylurea, 97%, N-(3-Aminophenyl)-n'-phenylurea, 95%. Offered by: Biosynth, AmBeed, Combi-blocks. Available pack sizes: 0,5g, 5g, 10g, 1g, 250mg, 100mg.
1-(3-aminophenyl)-3-phenylurea (CAS 66695-96-3) is a chemical compound with the molecular formula C13H13N3O and a molecular weight of 227.26 g/mol. IUPAC name: 1-(3-aminophenyl)-3-phenylurea. InChIKey: HEPNAISIYKJLIZ-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 1-(3-aminophenyl)-3-phenylurea |
| InChIKey | HEPNAISIYKJLIZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)NC2=CC=CC(=C2)N |
Computed by PubChem (NCBI)