Products 785-30-8
CAS 785-30-8 appears in our catalog under these names: 4,4'-Diaminobenzanilide, 98%, 4,4′–Diaminobenzanilide, 4,4'-Diaminobenzanilide, 98% , 4,4²-Diaminobenzanilide, 4,4'-Diaminobenzanilide, >98.0%(HPLC)(T). Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 100g, 5g, 500g, 25g, 10g, 50g, 2,5g, 0,25g.
4-amino-N-(4-aminophenyl)benzamide (CAS 785-30-8) is a chemical compound with the molecular formula C13H13N3O and a molecular weight of 227.26 g/mol. IUPAC name: 4-amino-N-(4-aminophenyl)benzamide. InChIKey: XPAQFJJCWGSXGJ-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 4-amino-N-(4-aminophenyl)benzamide |
| InChIKey | XPAQFJJCWGSXGJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC2=CC=C(C=C2)N)N |
Computed by PubChem (NCBI)