cas: 2051-07-2 — see every product listed under this CAS number, including other names
1,4-Pentadien-3-one, 1,5-bis(4-methoxyphenyl)-, 96% (CAS 2051-07-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F980141-1G |
| cas | 2051-07-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 237.43 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
1,5-bis(4-methoxyphenyl)penta-1,4-dien-3-one (CAS 2051-07-2) is a chemical compound with the molecular formula C19H18O3 and a molecular weight of 294.3 g/mol. IUPAC name: 1,5-bis(4-methoxyphenyl)penta-1,4-dien-3-one. InChIKey: IOZVKDXPBWBUKY-UHFFFAOYSA-N.
| Molecular formula | C19H18O3 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 1,5-bis(4-methoxyphenyl)penta-1,4-dien-3-one |
| InChIKey | IOZVKDXPBWBUKY-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C=CC(=O)C=CC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)