cas: 2051-07-2 — see every product listed under this CAS number, including other names
1,5-Bis(4-methoxyphenyl)penta-1,4-dien-3-one 95% (CAS 2051-07-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A137333-1g |
| cas | 2051-07-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 442.69 Pln | |
| Ambeed | 25g | 1360.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A137333 |
1,5-bis(4-methoxyphenyl)penta-1,4-dien-3-one (CAS 2051-07-2) is a chemical compound with the molecular formula C19H18O3 and a molecular weight of 294.3 g/mol. IUPAC name: 1,5-bis(4-methoxyphenyl)penta-1,4-dien-3-one. InChIKey: IOZVKDXPBWBUKY-UHFFFAOYSA-N.
| Molecular formula | C19H18O3 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 1,5-bis(4-methoxyphenyl)penta-1,4-dien-3-one |
| InChIKey | IOZVKDXPBWBUKY-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C=CC(=O)C=CC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)