cas: 2051-07-2 — see every product listed under this CAS number, including other names
1,5-Bis(4-methoxyphenyl)penta-1,4-dien-3-one, 96%, 96% (CAS 2051-07-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1130UJ-250mg |
| cas | 2051-07-2 |
| size | 250mg |
| availability | 6.365g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 150.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
1,5-bis(4-methoxyphenyl)penta-1,4-dien-3-one (CAS 2051-07-2) is a chemical compound with the molecular formula C19H18O3 and a molecular weight of 294.3 g/mol. IUPAC name: 1,5-bis(4-methoxyphenyl)penta-1,4-dien-3-one. InChIKey: IOZVKDXPBWBUKY-UHFFFAOYSA-N.
| Molecular formula | C19H18O3 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 1,5-bis(4-methoxyphenyl)penta-1,4-dien-3-one |
| InChIKey | IOZVKDXPBWBUKY-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C=CC(=O)C=CC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)