cas: 154-58-5 — see every product listed under this CAS number, including other names
1,5-Anhydrosorbitol, 97% (CAS 154-58-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F608507-50MG |
| cas | 154-58-5 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 404.04 Pln | |
| Fluorochem | 100mg | 466.52 Pln | |
| Fluorochem | 250mg | 758.08 Pln | |
| Fluorochem | 1g | 1528.65 Pln | |
| Fluorochem | 5g | 7104.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1,5-anhydro-D-glucitol is an anhydro sugar of D-glucitol. It has a role as a human metabolite. It is functionally related to a D-glucitol.
Source: ChEBI
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (2R,3S,4R,5S)-2-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | MPCAJMNYNOGXPB-SLPGGIOYSA-N |
| SMILES | C1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)