CAS 27299-12-3 appears in our catalog under these names: Isosorbide Impurity 12, 1,4-Anhydro-d-glucitol, 95%, 1,4-Anhydro-D-sorbitol, >95% (HPLC), 1,4–Anhydro–D–glucitol, 1,4-Anhydro-D-glucitol, min. 95 %, 2 g. Offered by: Chemat Brand, Combi-blocks, TRC, GLPBio, Roth. Available pack sizes: on request, 1g, 5g, 250mg, 500mg, 2g, 10g, 100mg.
(2R,3R,4S)-2-[(1R)-1,2-dihydroxyethyl]oxolane-3,4-diol (CAS 27299-12-3) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. IUPAC name: (2R,3R,4S)-2-[(1R)-1,2-dihydroxyethyl]oxolane-3,4-diol. InChIKey: JNYAEWCLZODPBN-JGWLITMVSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (2R,3R,4S)-2-[(1R)-1,2-dihydroxyethyl]oxolane-3,4-diol |
| InChIKey | JNYAEWCLZODPBN-JGWLITMVSA-N |
| SMILES | C1[C@@H]([C@H]([C@H](O1)[C@@H](CO)O)O)O |
Computed by PubChem (NCBI)