cas: 538-62-5 — see every product listed under this CAS number, including other names
1,5-difenylokarbazon czda (CAS 538-62-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g. Offered by: Chempur.
| brand | Chempur |
|---|---|
| catalog number | chem-113371904-1g |
| cas | 538-62-5 |
| size | 1g |
| availability | 2 tygodnie | 2 weeks |
| brand | size | price | |
|---|---|---|---|
| Chempur | 1g | 73.18 Pln | |
| Chempur | 5g | 213.69 Pln | |
| Chempur | 10g | 327.86 Pln | |
| Chempur | 25g | 538.64 Pln | |
| Chempur | 50g | 802.10 Pln |
| delivery time | 2 weeks |
|---|---|
| purity | czda |
1-anilino-3-phenyliminourea (CAS 538-62-5) is a chemical compound with the molecular formula C13H12N4O and a molecular weight of 240.26 g/mol. IUPAC name: 1-anilino-3-phenyliminourea. InChIKey: ZFWAHZCOKGWUIT-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 1-anilino-3-phenyliminourea |
| InChIKey | ZFWAHZCOKGWUIT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NNC(=O)N=NC2=CC=CC=C2 |
Computed by PubChem (NCBI)