Products 2755871-02-2
CAS 2755871-02-2 appears in our catalog under these names: Nitrosamine Impurity 1, N-Nitroso Varenicline, >95% (HPLC), N-Nitrosovarenicline, N-Nitrosovarenicline 0.1 mg/ml in Methanol, N-NITROSO VARENICLINE (NNV). Offered by: Chemat Brand, TRC, Mikromol, Sigma-Aldrich. Available pack sizes: on request, 100mg, 250mg, 25mg, 1ml, 10MG.
14-nitroso-5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaene (CAS 2755871-02-2) is a chemical compound with the molecular formula C13H12N4O and a molecular weight of 240.26 g/mol. IUPAC name: 14-nitroso-5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaene. InChIKey: PTBAEGOZXFWTJH-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 14-nitroso-5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaene |
| InChIKey | PTBAEGOZXFWTJH-UHFFFAOYSA-N |
| SMILES | C1C2CN(CC1C3=CC4=NC=CN=C4C=C23)N=O |
Computed by PubChem (NCBI)