cas: 129848-59-5 — see every product listed under this CAS number, including other names
1,6,7,8-Tetrahydrocyclopenta[g]indole, 95%, 95% (CAS 129848-59-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HRZA-100mg |
| cas | 129848-59-5 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 3506.00 Pln | |
| Chemat | 500mg | 12669.20 Pln | |
| Chemat | 1g | 17080.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,6,7,8-tetrahydrocyclopenta[g]indole (CAS 129848-59-5) is a chemical compound with the molecular formula C11H11N and a molecular weight of 157.21 g/mol. IUPAC name: 1,6,7,8-tetrahydrocyclopenta[g]indole. InChIKey: OGAMTYAYYRHIKY-UHFFFAOYSA-N.
| Molecular formula | C11H11N |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | 1,6,7,8-tetrahydrocyclopenta[g]indole |
| InChIKey | OGAMTYAYYRHIKY-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C3=C(C=C2)C=CN3 |
Computed by PubChem (NCBI)