CAS 93-37-8 appears in our catalog under these names: 2,7-Dimethylquinoline, 95%, 2,7–Dimethylquinoline, 2,7-Dimethylquinoline 98%, 2,7-Dimethylquinoline, 98%, 98%, 2,7-Dimethylquinoline, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.
2,7-dimethylquinoline (CAS 93-37-8) is a chemical compound with the molecular formula C11H11N and a molecular weight of 157.21 g/mol. IUPAC name: 2,7-dimethylquinoline. InChIKey: QXKPLNCZSFACPU-UHFFFAOYSA-N.
| Molecular formula | C11H11N |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | 2,7-dimethylquinoline |
| InChIKey | QXKPLNCZSFACPU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C=CC(=N2)C |
Computed by PubChem (NCBI)