CAS 2436-93-3 is the registry number for 6,8-Dimethylquinoline, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
6,8-dimethylquinoline (CAS 2436-93-3) is a chemical compound with the molecular formula C11H11N and a molecular weight of 157.21 g/mol. IUPAC name: 6,8-dimethylquinoline. InChIKey: RLZSSWLXBLSQKI-UHFFFAOYSA-N.
| Molecular formula | C11H11N |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | 6,8-dimethylquinoline |
| InChIKey | RLZSSWLXBLSQKI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C=CC=N2)C |
Computed by PubChem (NCBI)