cas: 66996-59-6 — see every product listed under this CAS number, including other names
1,6-Dibromo-2-methoxynaphthalene 98% (CAS 66996-59-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A737141-100mg |
| cas | 66996-59-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 236.88 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 832.06 Pln | |
| Ambeed | 5g | 2740.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A737141 |
1,6-dibromo-2-methoxynaphthalene (CAS 66996-59-6) is a chemical compound with the molecular formula C11H8Br2O and a molecular weight of 315.99 g/mol. IUPAC name: 1,6-dibromo-2-methoxynaphthalene. InChIKey: HFEOLDKRKNUVAD-UHFFFAOYSA-N.
| Molecular formula | C11H8Br2O |
|---|---|
| Molecular weight | 315.99 g/mol |
| IUPAC name | 1,6-dibromo-2-methoxynaphthalene |
| InChIKey | HFEOLDKRKNUVAD-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C=C(C=C2)Br)Br |
Computed by PubChem (NCBI)