CAS 66996-59-6 appears in our catalog under these names: 1,6-Dibromo-2-methoxynaphthalene, 98%, 1,6-Dibromo-2-methoxynaphthalene 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 100mg, 250mg.
1,6-dibromo-2-methoxynaphthalene (CAS 66996-59-6) is a chemical compound with the molecular formula C11H8Br2O and a molecular weight of 315.99 g/mol. IUPAC name: 1,6-dibromo-2-methoxynaphthalene. InChIKey: HFEOLDKRKNUVAD-UHFFFAOYSA-N.
| Molecular formula | C11H8Br2O |
|---|---|
| Molecular weight | 315.99 g/mol |
| IUPAC name | 1,6-dibromo-2-methoxynaphthalene |
| InChIKey | HFEOLDKRKNUVAD-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C=C(C=C2)Br)Br |
Computed by PubChem (NCBI)