CAS 28768-94-7 appears in our catalog under these names: 2,4-Dibromo-1-methoxynaphthalene, 95%, 2,4–Dibromo–1–methoxynaphthalene, 2,4-Dibromo-1-methoxynaphthalene. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
2,4-dibromo-1-methoxynaphthalene (CAS 28768-94-7) is a chemical compound with the molecular formula C11H8Br2O and a molecular weight of 315.99 g/mol. IUPAC name: 2,4-dibromo-1-methoxynaphthalene. InChIKey: HNLGVRSNVMKQMJ-UHFFFAOYSA-N.
| Molecular formula | C11H8Br2O |
|---|---|
| Molecular weight | 315.99 g/mol |
| IUPAC name | 2,4-dibromo-1-methoxynaphthalene |
| InChIKey | HNLGVRSNVMKQMJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C2=CC=CC=C21)Br)Br |
Computed by PubChem (NCBI)