1,6-Dibromoisoquinolin-3-amine, 95%
cas: 925672-85-1 — see every product listed under this CAS number, including other names
1,6-Dibromoisoquinolin-3-amine, 95% (CAS 925672-85-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A184943-250mg |
| cas | 925672-85-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 642.94 Pln | |
| Ambeed | 5g | 1783.25 Pln | |
| Chemat | 100mg | 501.20 Pln | |
| Chemat | 250mg | 794.00 Pln | |
| BLDpharm | 100mg | 281.04 Pln | |
| BLDpharm | 250mg | 325.47 Pln | |
| BLDpharm | 1g | 686.45 Pln | |
| BLDpharm | 5g | 1919.35 Pln | |
| Fluorochem | 100mg | 919.49 Pln | |
| Fluorochem | 250mg | 1466.17 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1,6-dibromoisoquinolin-3-amine (CAS 925672-85-1) is a chemical compound with the molecular formula C9H6Br2N2 and a molecular weight of 301.96 g/mol. IUPAC name: 1,6-dibromoisoquinolin-3-amine. InChIKey: QWCRSSNILAZCCN-UHFFFAOYSA-N.
| Molecular formula | C9H6Br2N2 |
|---|---|
| Molecular weight | 301.96 g/mol |
| IUPAC name | 1,6-dibromoisoquinolin-3-amine |
| InChIKey | QWCRSSNILAZCCN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C(C=C2C=C1Br)N)Br |
Computed by PubChem (NCBI)