CAS 3026728-34-4 is the registry number for 2,4-dibromo-7-methylquinazoline, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg.
2,4-dibromo-7-methylquinazoline (CAS 3026728-34-4) is a chemical compound with the molecular formula C9H6Br2N2 and a molecular weight of 301.96 g/mol. IUPAC name: 2,4-dibromo-7-methylquinazoline. InChIKey: JMTMGPPIOFRYOL-UHFFFAOYSA-N.
| Molecular formula | C9H6Br2N2 |
|---|---|
| Molecular weight | 301.96 g/mol |
| IUPAC name | 2,4-dibromo-7-methylquinazoline |
| InChIKey | JMTMGPPIOFRYOL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=NC(=N2)Br)Br |
Computed by PubChem (NCBI)