CAS 36107-02-5 appears in our catalog under these names: 5,7-Dibromoquinolin-8-amine, 98%, 98%, 5,7-Dibromoquinolin-8-amine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
5,7-dibromoquinolin-8-amine (CAS 36107-02-5) is a chemical compound with the molecular formula C9H6Br2N2 and a molecular weight of 301.96 g/mol. IUPAC name: 5,7-dibromoquinolin-8-amine. InChIKey: SMXOUFFPKVBWEE-UHFFFAOYSA-N.
| Molecular formula | C9H6Br2N2 |
|---|---|
| Molecular weight | 301.96 g/mol |
| IUPAC name | 5,7-dibromoquinolin-8-amine |
| InChIKey | SMXOUFFPKVBWEE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C(C=C2Br)Br)N)N=C1 |
Computed by PubChem (NCBI)