cas: 38303-35-4 — see every product listed under this CAS number, including other names
1,8-Dibromopyrene 97% (CAS 38303-35-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A469863-100mg |
| cas | 38303-35-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 426.00 Pln | |
| Ambeed | 1g | 1032.31 Pln | |
| Ambeed | 5g | 3440.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A469863 |
1,8-dibromopyrene (CAS 38303-35-4) is a chemical compound with the molecular formula C16H8Br2 and a molecular weight of 360.04 g/mol. IUPAC name: 1,8-dibromopyrene. InChIKey: JBLQSCAVCHTKPV-UHFFFAOYSA-N.
| Molecular formula | C16H8Br2 |
|---|---|
| Molecular weight | 360.04 g/mol |
| IUPAC name | 1,8-dibromopyrene |
| InChIKey | JBLQSCAVCHTKPV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C(C=C2)Br)C=CC4=C(C=CC1=C43)Br |
Computed by PubChem (NCBI)