1,8-Dibromopyrene, 97%
cas: 38303-35-4 — see every product listed under this CAS number, including other names
1,8-Dibromopyrene, 97% (CAS 38303-35-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F325018-100MG |
| cas | 38303-35-4 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 268.67 Pln | |
| Fluorochem | 250mg | 404.04 Pln | |
| Fluorochem | 1g | 997.58 Pln | |
| Fluorochem | 5g | 3423.81 Pln | |
| Fluorochem | 10g | 4876.43 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1,8-dibromopyrene (CAS 38303-35-4) is a chemical compound with the molecular formula C16H8Br2 and a molecular weight of 360.04 g/mol. IUPAC name: 1,8-dibromopyrene. InChIKey: JBLQSCAVCHTKPV-UHFFFAOYSA-N.
| Molecular formula | C16H8Br2 |
|---|---|
| Molecular weight | 360.04 g/mol |
| IUPAC name | 1,8-dibromopyrene |
| InChIKey | JBLQSCAVCHTKPV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C(C=C2)Br)C=CC4=C(C=CC1=C43)Br |
Computed by PubChem (NCBI)
Synonyms:
1,8-dibromopyrene, Pyrene, 1,8-dibromo-