1,8-Dibromopyrene, 97%
cas: 38303-35-4 — see every product listed under this CAS number, including other names
1,8-Dibromopyrene, 97% (CAS 38303-35-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A469863-250mg |
| cas | 38303-35-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 431.56 Pln | |
| Ambeed | 1g | 1043.44 Pln | |
| Ambeed | 5g | 3479.81 Pln | |
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 1g | 760.40 Pln | |
| Chemat | 5g | 2186.00 Pln | |
| BLDpharm | 100mg | 297.70 Pln | |
| BLDpharm | 250mg | 458.75 Pln | |
| BLDpharm | 1g | 1119.63 Pln | |
| BLDpharm | 5g | 3746.48 Pln | |
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 424.87 Pln | |
| Fluorochem | 1g | 1044.44 Pln | |
| Fluorochem | 5g | 3527.94 Pln | |
| Fluorochem | 10g | 5022.21 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1,8-dibromopyrene (CAS 38303-35-4) is a chemical compound with the molecular formula C16H8Br2 and a molecular weight of 360.04 g/mol. IUPAC name: 1,8-dibromopyrene. InChIKey: JBLQSCAVCHTKPV-UHFFFAOYSA-N.
| Molecular formula | C16H8Br2 |
|---|---|
| Molecular weight | 360.04 g/mol |
| IUPAC name | 1,8-dibromopyrene |
| InChIKey | JBLQSCAVCHTKPV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C(C=C2)Br)C=CC4=C(C=CC1=C43)Br |
Computed by PubChem (NCBI)
Synonyms:
1,8-dibromopyrene, Pyrene, 1,8-dibromo-