CAS 38303-35-4 appears in our catalog under these names: 1,8-Dibromopyrene, 95%, 1,8–Dibromopyrene, 1,8-Dibromopyrene 97%, 1,8-Dibromopyrene, 97%, 97%, 1,8-Dibromopyrene, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 50mg, 5g, 10g.
1,8-dibromopyrene (CAS 38303-35-4) is a chemical compound with the molecular formula C16H8Br2 and a molecular weight of 360.04 g/mol. IUPAC name: 1,8-dibromopyrene. InChIKey: JBLQSCAVCHTKPV-UHFFFAOYSA-N.
| Molecular formula | C16H8Br2 |
|---|---|
| Molecular weight | 360.04 g/mol |
| IUPAC name | 1,8-dibromopyrene |
| InChIKey | JBLQSCAVCHTKPV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C(C=C2)Br)C=CC4=C(C=CC1=C43)Br |
Computed by PubChem (NCBI)