cas: 49655-93-8 — see every product listed under this CAS number, including other names
1,8-NAPHTHYRIDINE-2,7-DIOL, 99%, 99% (CAS 49655-93-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DFCT-100mg |
| cas | 49655-93-8 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 875.60 Pln | |
| Chemat | 250mg | 1346.00 Pln | |
| Chemat | 500mg | 2104.40 Pln | |
| Chemat | 1g | 3318.80 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
1,8-dihydro-1,8-naphthyridine-2,7-dione (CAS 49655-93-8) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 1,8-dihydro-1,8-naphthyridine-2,7-dione. InChIKey: LJALSNRALPCDMH-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 1,8-dihydro-1,8-naphthyridine-2,7-dione |
| InChIKey | LJALSNRALPCDMH-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC2=C1C=CC(=O)N2 |
Computed by PubChem (NCBI)