CAS 2069617-23-6 is the registry number for 2H-Indazole-7-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
1H-indazole-7-carboxylic acid (CAS 2069617-23-6) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 1H-indazole-7-carboxylic acid. InChIKey: WBCWIQCXHSXMDH-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 1H-indazole-7-carboxylic acid |
| InChIKey | WBCWIQCXHSXMDH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)O)NN=C2 |
Computed by PubChem (NCBI)