CAS 1199-02-6 appears in our catalog under these names: 5-phenyl-1,3,4-oxadiazol-2-ol, 98%, 5-Phenyl-3H-1,3,4-oxadiazol-2-one, 98%, 5-Phenyl-1,3,4-oxadiazol-2-ol, 96%, 5-Phenyl-1,3,4-oxadiazol-2(3H)-one, 98%. Offered by: Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 10g, 5g, 1g, 25g, 250mg.
5-phenyl-3H-1,3,4-oxadiazol-2-one (CAS 1199-02-6) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 5-phenyl-3H-1,3,4-oxadiazol-2-one. InChIKey: RFJQGIYJJLWZJP-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 5-phenyl-3H-1,3,4-oxadiazol-2-one |
| InChIKey | RFJQGIYJJLWZJP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=O)O2 |
Computed by PubChem (NCBI)