cas: 59514-86-2 — see every product listed under this CAS number, including other names
1,8-Naphthyridine-2,4-diol (CAS 59514-86-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 1g. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | JCA51486-5g |
| cas | 59514-86-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 5g | price on request | |
| Biosynth | 0,5g | price on request | |
| Fluorochem | 100mg | 643.54 Pln | |
| Fluorochem | 250mg | 1049.65 Pln | |
| Fluorochem | 1g | 2283.59 Pln | |
| Fluorochem | 5g | 5844.83 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Building Blocks |
| purity | No data |
| delivery time | 3-4 weeks |
4-hydroxy-1H-1,8-naphthyridin-2-one (CAS 59514-86-2) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 4-hydroxy-1H-1,8-naphthyridin-2-one. InChIKey: LUORZZNCJWKOSX-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 4-hydroxy-1H-1,8-naphthyridin-2-one |
| InChIKey | LUORZZNCJWKOSX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NC(=O)C=C2O)N=C1 |
Computed by PubChem (NCBI)