CAS 2446818-31-9 is the registry number for tert-Butyl ((3S,4R)-4-hydroxy-2-oxopyrrolidin-3-yl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(3S,4R)-4-hydroxy-2-oxopyrrolidin-3-yl]carbamate (CAS 2446818-31-9) is a chemical compound with the molecular formula C9H16N2O4 and a molecular weight of 216.23 g/mol. IUPAC name: tert-butyl N-[(3S,4R)-4-hydroxy-2-oxopyrrolidin-3-yl]carbamate. InChIKey: DSIHSTOMFIUCKI-RITPCOANSA-N.
| Molecular formula | C9H16N2O4 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | tert-butyl N-[(3S,4R)-4-hydroxy-2-oxopyrrolidin-3-yl]carbamate |
| InChIKey | DSIHSTOMFIUCKI-RITPCOANSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1[C@@H](CNC1=O)O |
Computed by PubChem (NCBI)