CAS 1408074-75-8 is the registry number for 2-Methyl-2,6-diazaspiro[3.4]octane oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-methyl-2,7-diazaspiro[3.4]octane;oxalic acid (CAS 1408074-75-8) is a chemical compound with the molecular formula C9H16N2O4 and a molecular weight of 216.23 g/mol. IUPAC name: 2-methyl-2,7-diazaspiro[3.4]octane;oxalic acid. InChIKey: SHUUQKINHURNAD-UHFFFAOYSA-N.
| Molecular formula | C9H16N2O4 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | 2-methyl-2,7-diazaspiro[3.4]octane;oxalic acid |
| InChIKey | SHUUQKINHURNAD-UHFFFAOYSA-N |
| SMILES | CN1CC2(C1)CCNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)