cas: 1779899-46-5 — see every product listed under this CAS number, including other names
1,3-Pyrrolidinedicarboxylic acid, 4-ethyl-, 1-(1,1-dimethylethyl) ester, 95%, 95% (CAS 1779899-46-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DTQ4-250mg |
| cas | 1779899-46-5 |
| size | 250mg |
| availability | 1.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 563.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-ethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 1779899-46-5) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 4-ethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: AYHWHPDMLFMSLP-UHFFFAOYSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 4-ethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | AYHWHPDMLFMSLP-UHFFFAOYSA-N |
| SMILES | CCC1CN(CC1C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)