cas: 25152-20-9 — see every product listed under this CAS number, including other names
1-((2R,4S,5R)-5-(Aminomethyl)-4-hydroxytetrahydrofuran-2-yl)-5-methylpyrimidine-2,4(1H,3H)-dione (CAS 25152-20-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113QNU-1mg |
| cas | 25152-20-9 |
| size | 1mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 208.40 Pln | |
| Chemat | 5mg | 386.00 Pln | |
| Chemat | 10mg | 525.20 Pln | |
| Chemat | 25mg | 822.80 Pln | |
| Chemat | 50mg | 1187.60 Pln | |
| Chemat | 100mg | 1725.20 Pln | |
| Chemat | 500mg | 4106.00 Pln |
| delivery time | 3 weeks |
|---|
1-[(2R,4S,5R)-5-(aminomethyl)-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (CAS 25152-20-9) is a chemical compound with the molecular formula C10H15N3O4 and a molecular weight of 241.24 g/mol. IUPAC name: 1-[(2R,4S,5R)-5-(aminomethyl)-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione. InChIKey: PYWLBQPICCQJFF-XLPZGREQSA-N.
| Molecular formula | C10H15N3O4 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-5-(aminomethyl)-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | PYWLBQPICCQJFF-XLPZGREQSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CN)O |
Computed by PubChem (NCBI)