CAS 916850-80-1 appears in our catalog under these names: 5-(tert-Butoxycarbonylamino)-1-methyl-1h-pyrazole-4-carboxylic acid, 95%, 5-((tert-Butoxycarbonyl)amino)-1-methyl-1H-pyrazole-4-carboxylic acid 95%, 1H-Pyrazole-4-carboxylic acid, 5-[[(1,1-dimethylethoxy)carbonyl]amino]-1-methyl-, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
1-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazole-4-carboxylic acid (CAS 916850-80-1) is a chemical compound with the molecular formula C10H15N3O4 and a molecular weight of 241.24 g/mol. IUPAC name: 1-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazole-4-carboxylic acid. InChIKey: QGGMHAWQLPZVEJ-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O4 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 1-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazole-4-carboxylic acid |
| InChIKey | QGGMHAWQLPZVEJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=NN1C)C(=O)O |
Computed by PubChem (NCBI)