CAS 867340-37-2 appears in our catalog under these names: 2-(Aminomethyl)-1H-imidazole-5-carboxylic acid, 2-BOC protected, 2-((tert-Butoxycarbonylamino)methyl)-1h-imidazole-5-carboxylic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 50mg, 1g, 250mg.
2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1H-imidazole-5-carboxylic acid (CAS 867340-37-2) is a chemical compound with the molecular formula C10H15N3O4 and a molecular weight of 241.24 g/mol. IUPAC name: 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1H-imidazole-5-carboxylic acid. InChIKey: BTQYGWFZYNSARA-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O4 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1H-imidazole-5-carboxylic acid |
| InChIKey | BTQYGWFZYNSARA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=NC=C(N1)C(=O)O |
Computed by PubChem (NCBI)