cas: 486422-19-9 — see every product listed under this CAS number, including other names
1-((3-bromophenyl)sulfonyl)-4-methylpiperazine 95+% (CAS 486422-19-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A251845-250mg |
| cas | 486422-19-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 364.81 Pln | |
| Ambeed | 5g | 1221.44 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A251845 |
1-(3-bromophenyl)sulfonyl-4-methylpiperazine (CAS 486422-19-9) is a chemical compound with the molecular formula C11H15BrN2O2S and a molecular weight of 319.22 g/mol. IUPAC name: 1-(3-bromophenyl)sulfonyl-4-methylpiperazine. InChIKey: XYSXYLKXIYXHPD-UHFFFAOYSA-N.
| Molecular formula | C11H15BrN2O2S |
|---|---|
| Molecular weight | 319.22 g/mol |
| IUPAC name | 1-(3-bromophenyl)sulfonyl-4-methylpiperazine |
| InChIKey | XYSXYLKXIYXHPD-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)S(=O)(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)