Products 2341943-53-9
CAS 2341943-53-9 is the registry number for tert-Butyl (1-(2-bromothiazol-4-yl)cyclopropyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[1-(2-bromo-1,3-thiazol-4-yl)cyclopropyl]carbamate (CAS 2341943-53-9) is a chemical compound with the molecular formula C11H15BrN2O2S and a molecular weight of 319.22 g/mol. IUPAC name: tert-butyl N-[1-(2-bromo-1,3-thiazol-4-yl)cyclopropyl]carbamate. InChIKey: FOWZFRIPGOOZKY-UHFFFAOYSA-N.
| Molecular formula | C11H15BrN2O2S |
|---|---|
| Molecular weight | 319.22 g/mol |
| IUPAC name | tert-butyl N-[1-(2-bromo-1,3-thiazol-4-yl)cyclopropyl]carbamate |
| InChIKey | FOWZFRIPGOOZKY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CC1)C2=CSC(=N2)Br |
Computed by PubChem (NCBI)