1-((4-Nitrophenyl)sulfonyl)-1H-1,2,4-triazole, 95%
cas: 57777-84-1 — see every product listed under this CAS number, including other names
1-((4-Nitrophenyl)sulfonyl)-1H-1,2,4-triazole, 95% (CAS 57777-84-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F224572-1G |
| cas | 57777-84-1 |
| size | 1g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 206.20 Pln | |
| Fluorochem | 25g | 539.41 Pln | |
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 25g | 281.38 Pln | |
| Ambeed | 100g | 765.31 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 25g | 297.70 Pln | |
| BLDpharm | 100g | 819.74 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
1-(4-nitrophenyl)sulfonyl-1,2,4-triazole (CAS 57777-84-1) is a chemical compound with the molecular formula C8H6N4O4S and a molecular weight of 254.23 g/mol. IUPAC name: 1-(4-nitrophenyl)sulfonyl-1,2,4-triazole. InChIKey: HMNOLKQVFZCVIW-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O4S |
|---|---|
| Molecular weight | 254.23 g/mol |
| IUPAC name | 1-(4-nitrophenyl)sulfonyl-1,2,4-triazole |
| InChIKey | HMNOLKQVFZCVIW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])S(=O)(=O)N2C=NC=N2 |
Computed by PubChem (NCBI)
Synonyms:
1-((4-Nitrophenyl)sulfonyl)-1H-1,2,4-triazole, 1-(4-Nitrobenzenesulfonyl)-1H-1,2,4-triazole, 1-(4-nitrophenyl)sulfonyl-1,2,4-triazole, 1-(4-Nitrophenylsulfonyl)-1H-1,2,4-triazole, 1-[(4-nitrophenyl)sulfonyl]-1h-1,2,4-triazole, p-NBST, 1-((4-Nitrophenyl)sulphonyl)-1H-1,2,4-triazole, 1-[(4-nitrophenyl)sulphonyl]-1H-1,2,4-triazole, 1-(4-Nitrophenylsulfonyl)-1,2,4-triazole, 1-(p-nitrobenzenesulfonyl)-1H-1,2,4-triazole