cas: 22184-97-0 — see every product listed under this CAS number, including other names
3-(Morpholine-4-sulfonyl)-aniline, 98% (CAS 22184-97-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014169-250MG |
| cas | 22184-97-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 1g | 565.44 Pln | |
| Fluorochem | 5g | 1768.15 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-morpholin-4-ylsulfonylaniline (CAS 22184-97-0) is a chemical compound with the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. IUPAC name: 3-morpholin-4-ylsulfonylaniline. InChIKey: FKFOJDYRQYJURJ-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O3S |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 3-morpholin-4-ylsulfonylaniline |
| InChIKey | FKFOJDYRQYJURJ-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)C2=CC=CC(=C2)N |
Computed by PubChem (NCBI)