cas: 126091-24-5 — see every product listed under this CAS number, including other names
3'-Trifluoromethylbiphenyl-3-carbaldehyde, 95% (CAS 126091-24-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014314-1G |
| cas | 126091-24-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 794.53 Pln | |
| Fluorochem | 25g | 3106.22 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-[3-(trifluoromethyl)phenyl]benzaldehyde (CAS 126091-24-5) is a chemical compound with the molecular formula C14H9F3O and a molecular weight of 250.21 g/mol. IUPAC name: 3-[3-(trifluoromethyl)phenyl]benzaldehyde. InChIKey: KSXHXCWTPJPLAT-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O |
|---|---|
| Molecular weight | 250.21 g/mol |
| IUPAC name | 3-[3-(trifluoromethyl)phenyl]benzaldehyde |
| InChIKey | KSXHXCWTPJPLAT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC(=CC=C2)C(F)(F)F)C=O |
Computed by PubChem (NCBI)