CAS 110826-97-6 appears in our catalog under these names: 1-([1,1'-Biphenyl]-3-yl)ethan-1-amine, 95%, 95%, 1-([1,1'-BIPHENYL]-3-YL)ETHAN-1-AMINE, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 10mg, 100mg, 250mg, 1g.
1-(3-phenylphenyl)ethanamine (CAS 110826-97-6) is a chemical compound with the molecular formula C14H15N and a molecular weight of 197.27 g/mol. IUPAC name: 1-(3-phenylphenyl)ethanamine. InChIKey: CHKUZHZWJGZNBC-UHFFFAOYSA-N.
| Molecular formula | C14H15N |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | 1-(3-phenylphenyl)ethanamine |
| InChIKey | CHKUZHZWJGZNBC-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC(=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)