CAS 17027-51-9 appears in our catalog under these names: 2-(4-Biphenyl)ethylamine, 95%, 2-(4-Biphenyl)ethylamine, 2-(4-BIPHENYL)ETHYLAMINE, 98%, 2-([1,1'-Biphenyl]-4-yl)ethanamine, 95%, 95%, 2-(4-Biphenyl)ethylamine, 98%(HPLC),RG. Offered by: Combi-blocks, Biosynth, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg.
2-(4-phenylphenyl)ethanamine (CAS 17027-51-9) is a chemical compound with the molecular formula C14H15N and a molecular weight of 197.27 g/mol. IUPAC name: 2-(4-phenylphenyl)ethanamine. InChIKey: WHPLBPSDTIZFSX-UHFFFAOYSA-N.
| Molecular formula | C14H15N |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | 2-(4-phenylphenyl)ethanamine |
| InChIKey | WHPLBPSDTIZFSX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CCN |
Computed by PubChem (NCBI)