CAS 20912-56-5 appears in our catalog under these names: 1,1-Diphenylethan-1-amine, 95%, 1,1-Diphenylethan-1-amine, 1,1-Diphenylethan-1-amine, 98%, 98%, 1,1-Diphenylethan-1-amine, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 2,5g, 100mg, 500mg.
1,1-diphenylethanamine (CAS 20912-56-5) is a chemical compound with the molecular formula C14H15N and a molecular weight of 197.27 g/mol. IUPAC name: 1,1-diphenylethanamine. InChIKey: XADXWWLTECVAAE-UHFFFAOYSA-N.
| Molecular formula | C14H15N |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | 1,1-diphenylethanamine |
| InChIKey | XADXWWLTECVAAE-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)(C2=CC=CC=C2)N |
Computed by PubChem (NCBI)