cas: 912444-89-4 — see every product listed under this CAS number, including other names
1-(1,1-Dimethylethyl) 4-ethyl 2,3,6,7-tetrahydro-1H-azepine-1,4-dicarboxylate, 95%, 95% (CAS 912444-89-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117DBW-250mg |
| cas | 912444-89-4 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 798.80 Pln | |
| Chemat | 1g | 1907.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 4-O-ethyl 2,3,6,7-tetrahydroazepine-1,4-dicarboxylate (CAS 912444-89-4) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl 2,3,6,7-tetrahydroazepine-1,4-dicarboxylate. InChIKey: OQQBVXIIESRTAD-UHFFFAOYSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-ethyl 2,3,6,7-tetrahydroazepine-1,4-dicarboxylate |
| InChIKey | OQQBVXIIESRTAD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CCCN(CC1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)