CAS 912444-89-4 appears in our catalog under these names: (E)-1-tert-Butyl 4-ethyl 2,3,6,7-tetrahydroazepine-1,4-dicarboxylate, 96%, 1-tert-Butyl 4-ethyl 2,3,6,7-tetrahydro-1H-azepine-1,4-dicarboxylate, 97%, 1–tert–Butyl 4–ethyl 2,3,6,7–tetrahydro–1H–azepine–1,4–dicarboxylate, 1-(1,1-Dimethylethyl) 4-ethyl 2,3,6,7-tetrahydro-1H-azepine-1,4-dicarboxylate, 95%, 95%, 1-tert-Butyl 4-ethyl 2,3,6,7-tetrahydro-1H-azepine-1,4-dicarboxylate, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
1-O-tert-butyl 4-O-ethyl 2,3,6,7-tetrahydroazepine-1,4-dicarboxylate (CAS 912444-89-4) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl 2,3,6,7-tetrahydroazepine-1,4-dicarboxylate. InChIKey: OQQBVXIIESRTAD-UHFFFAOYSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-ethyl 2,3,6,7-tetrahydroazepine-1,4-dicarboxylate |
| InChIKey | OQQBVXIIESRTAD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CCCN(CC1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)