1-(1,5-Dimethyl-1H-imidazol-2-yl)piperazine dihydrochloride, 97%
cas: 1956380-83-8 — see every product listed under this CAS number, including other names
1-(1,5-Dimethyl-1H-imidazol-2-yl)piperazine dihydrochloride, 97% (CAS 1956380-83-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A296133-250mg |
| cas | 1956380-83-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 2317.25 Pln | |
| Ambeed | 1g | 7084.31 Pln | |
| Chemat | 50mg | 582.80 Pln | |
| Chemat | 100mg | 842.00 Pln | |
| Chemat | 250mg | 1619.60 Pln | |
| Chemat | 1g | 4715.60 Pln | |
| BLDpharm | 50mg | 819.74 Pln | |
| BLDpharm | 100mg | 1336.22 Pln | |
| BLDpharm | 250mg | 2496.92 Pln | |
| BLDpharm | 1g | 7634.00 Pln | |
| Fluorochem | 50mg | 1075.68 Pln | |
| Fluorochem | 100mg | 1559.89 Pln | |
| Fluorochem | 250mg | 3012.50 Pln | |
| Fluorochem | 1g | 8588.66 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
1-(1,5-dimethylimidazol-2-yl)piperazine;dihydrochloride (CAS 1956380-83-8) is a chemical compound with the molecular formula C9H18Cl2N4 and a molecular weight of 253.17 g/mol. IUPAC name: 1-(1,5-dimethylimidazol-2-yl)piperazine;dihydrochloride. InChIKey: KQTIUWZEDRNFDS-UHFFFAOYSA-N.
| Molecular formula | C9H18Cl2N4 |
|---|---|
| Molecular weight | 253.17 g/mol |
| IUPAC name | 1-(1,5-dimethylimidazol-2-yl)piperazine;dihydrochloride |
| InChIKey | KQTIUWZEDRNFDS-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(N1C)N2CCNCC2.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
1-(1,5-Dimethyl-1H-imidazol-2-yl)piperazine dihydrochloride, 1-(1,5-dimethylimidazol-2-yl)piperazine;dihydrochloride, 1-(1,5-Dimethyl-1H-imidazol-2-yl)piperazine diHCl, 1-(1,5-Dimethyl-1H-imidazol-2-yl)piperazinedihydrochloride, Piperazine, 1-(1,5-dimethyl-1H-imidazol-2-yl)-, hydrochloride