Products 2287274-86-4
CAS 2287274-86-4 is the registry number for rac-(1R,4R)-4-(5-Methyl-1H-1,2,4-triazol-3-yl)cyclohexan-1-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclohexan-1-amine;dihydrochloride (CAS 2287274-86-4) is a chemical compound with the molecular formula C9H18Cl2N4 and a molecular weight of 253.17 g/mol. IUPAC name: 4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclohexan-1-amine;dihydrochloride. InChIKey: ALIJEEPRUZFSMI-UHFFFAOYSA-N.
| Molecular formula | C9H18Cl2N4 |
|---|---|
| Molecular weight | 253.17 g/mol |
| IUPAC name | 4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclohexan-1-amine;dihydrochloride |
| InChIKey | ALIJEEPRUZFSMI-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NN1)C2CCC(CC2)N.Cl.Cl |
Computed by PubChem (NCBI)