CAS 1269052-78-9 is the registry number for 1,5-Dimethyl-3-(1-pyrrolidinyl)-1h-pyrazol-4-amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
1,5-dimethyl-3-pyrrolidin-1-ylpyrazol-4-amine;dihydrochloride (CAS 1269052-78-9) is a chemical compound with the molecular formula C9H18Cl2N4 and a molecular weight of 253.17 g/mol. IUPAC name: 1,5-dimethyl-3-pyrrolidin-1-ylpyrazol-4-amine;dihydrochloride. InChIKey: ORHBZXCLAFUDQC-UHFFFAOYSA-N.
| Molecular formula | C9H18Cl2N4 |
|---|---|
| Molecular weight | 253.17 g/mol |
| IUPAC name | 1,5-dimethyl-3-pyrrolidin-1-ylpyrazol-4-amine;dihydrochloride |
| InChIKey | ORHBZXCLAFUDQC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C)N2CCCC2)N.Cl.Cl |
Computed by PubChem (NCBI)