cas: 69642-00-8 — see every product listed under this CAS number, including other names
1-(1-Bromoethyl)-2-nitrobenzene 95% (CAS 69642-00-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1112975-250mg |
| cas | 69642-00-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 420.44 Pln | |
| Ambeed | 1g | 1115.75 Pln | |
| Ambeed | 5g | 3735.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1112975 |
1-(1-bromoethyl)-2-nitrobenzene (CAS 69642-00-8) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 1-(1-bromoethyl)-2-nitrobenzene. InChIKey: FHKIGGSCRYVAMY-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 1-(1-bromoethyl)-2-nitrobenzene |
| InChIKey | FHKIGGSCRYVAMY-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1[N+](=O)[O-])Br |
Computed by PubChem (NCBI)