Products 1514782-62-7
CAS 1514782-62-7 is the registry number for 3-(3-Bromopyridin-2-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(3-bromo-2-pyridinyl)propanoic acid (CAS 1514782-62-7) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 3-(3-bromo-2-pyridinyl)propanoic acid. InChIKey: CDGCPSMHRTXCRI-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 3-(3-bromo-2-pyridinyl)propanoic acid |
| InChIKey | CDGCPSMHRTXCRI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)CCC(=O)O)Br |
Computed by PubChem (NCBI)