Products 101421-63-0
CAS 101421-63-0 is the registry number for 1-Bromo-2,3-dimethyl-4-nitrobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-bromo-2,3-dimethyl-4-nitrobenzene (CAS 101421-63-0) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 1-bromo-2,3-dimethyl-4-nitrobenzene. InChIKey: PQSZBOYJFKZYQO-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 1-bromo-2,3-dimethyl-4-nitrobenzene |
| InChIKey | PQSZBOYJFKZYQO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)