cas: 780027-85-2 — see every product listed under this CAS number, including other names
1-(2,3,4-Trifluorophenyl)ethanamine 97% (CAS 780027-85-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A840637-100mg |
| cas | 780027-85-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 170.12 Pln | |
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 932.19 Pln | |
| Ambeed | 5g | 4258.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A840637 |
1-(2,3,4-trifluorophenyl)ethanamine (CAS 780027-85-2) is a chemical compound with the molecular formula C8H8F3N and a molecular weight of 175.15 g/mol. IUPAC name: 1-(2,3,4-trifluorophenyl)ethanamine. InChIKey: OFWOWFVJVVUHSM-UHFFFAOYSA-N.
| Molecular formula | C8H8F3N |
|---|---|
| Molecular weight | 175.15 g/mol |
| IUPAC name | 1-(2,3,4-trifluorophenyl)ethanamine |
| InChIKey | OFWOWFVJVVUHSM-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C(=C(C=C1)F)F)F)N |
Computed by PubChem (NCBI)