CAS 1241683-28-2 is the registry number for (S)-1-(2,3,4-Trifluorophenyl)ethan-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(2,3,4-trifluorophenyl)ethanamine (CAS 1241683-28-2) is a chemical compound with the molecular formula C8H8F3N and a molecular weight of 175.15 g/mol. IUPAC name: (1S)-1-(2,3,4-trifluorophenyl)ethanamine. InChIKey: OFWOWFVJVVUHSM-BYPYZUCNSA-N.
| Molecular formula | C8H8F3N |
|---|---|
| Molecular weight | 175.15 g/mol |
| IUPAC name | (1S)-1-(2,3,4-trifluorophenyl)ethanamine |
| InChIKey | OFWOWFVJVVUHSM-BYPYZUCNSA-N |
| SMILES | C[C@@H](C1=C(C(=C(C=C1)F)F)F)N |
Computed by PubChem (NCBI)