cas: 1221723-48-3 — see every product listed under this CAS number, including other names
1-(2,3-Dimethoxybenzoyl)piperazine hydrochloride, 98% (CAS 1221723-48-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1113066-10g |
| cas | 1221723-48-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 19365.64 Pln | |
| AmBeed | 5g | 12341.35 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2,3-dimethoxyphenyl)-piperazin-1-ylmethanone;hydrochloride (CAS 1221723-48-3) is a chemical compound with the molecular formula C13H19ClN2O3 and a molecular weight of 286.75 g/mol. IUPAC name: (2,3-dimethoxyphenyl)-piperazin-1-ylmethanone;hydrochloride. InChIKey: JSUVLJZEBFRDPA-UHFFFAOYSA-N.
| Molecular formula | C13H19ClN2O3 |
|---|---|
| Molecular weight | 286.75 g/mol |
| IUPAC name | (2,3-dimethoxyphenyl)-piperazin-1-ylmethanone;hydrochloride |
| InChIKey | JSUVLJZEBFRDPA-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1OC)C(=O)N2CCNCC2.Cl |
Computed by PubChem (NCBI)